Dicarbonyl Compounds
Sigma Aldrich Fine Chemicals Biosciences Ethyl acetoacetate natural, >=97%, FG | 141-97-9 | MFCD00009199 | 100G
Ethyl acetoacetate natural, >=97%, FG | Purity: >=97% | Mol Wt: 130.14 | 141-97-9 | MFCD00009199 | 100G
eMolecules 1906-95-2 | (5-Bromopentyl)malonic acid diethyl ester | Combi-Blocks | MFCD00048565 | 309.200 | C12H21BrO4 | 95.000 | CCOC(=O)C(CCCCCBr)C(=O)OCC | 1g | 267197793
(5-Bromopentyl)malonic acid diethyl ester | Combi-Blocks | 1906-95-2 | MFCD00048565 | 309.200 | C12H21BrO4 | 95.000 | CCOC(=O)C(CCCCCBr)C(=O)OCC | 1g | 267197793
eMolecules 108-13-4 | Malonamide | Oakwood Chemicals | MFCD00008034 | 102.093 | C3H6N2O2 | 97.000 | NC(=O)CC(N)=O | 5g | 480145882
Malonamide | Oakwood Chemicals | 108-13-4 | MFCD00008034 | 102.093 | C3H6N2O2 | 97.000 | NC(=O)CC(N)=O | 5g | 480145882
eMolecules 105-53-3 | Diethyl malonate | Chem-Impex | MFCD00009195 | 160.169 | C7H12O4 | 99.000 | CCOC(=O)CC(=O)OCC | 5kg | 490849109
Diethyl malonate | Chem-Impex | 105-53-3 | MFCD00009195 | 160.169 | C7H12O4 | 99.000 | CCOC(=O)CC(=O)OCC | 5kg | 490849109
Apexbio Technology LLC Malonic acid 141-82-2 100mg
Malonic acid is a small-molecule dicarboxylic acid It is commonly used to facilitate the cross-linking of polysaccharide molecules such as corn starch and potato starch by forming covalent linkages via its two carboxyl groups Malonic acid acts primarily through condensation or esterification reactions to increase intermolecular connectivity and modulate the mechanical properties of biopolymer matrices Based on these properties malonic acid holds research potential in pharmaceutical excipient formulation drug delivery system development and biomaterial engineering studies
eMolecules 108-59-8 | Dimethyl malonate | AA Blocks LLC | MFCD00008460 | 132.115 | C5H8O4 | 0.000 | COC(=O)CC(=O)OC | 100g | 448662548
Dimethyl malonate | AA Blocks LLC | 108-59-8 | MFCD00008460 | 132.115 | C5H8O4 | 0.000 | COC(=O)CC(=O)OC | 100g | 448662548
Cambridge Isotope Laboratories ETHYL ACETOACETATE (3-13C, 99%), 1 G, 61973-42-0
ETHYL ACETOACETATE (3-13C, 99%), 1 G, 61973-42-0
Medchemexpress LLC Dimethyl malonate | 108-59-8 | MFCD00008460 | 500mg
Dimethyl malonate is a competitive inhibitor of succinate dehydrogenase (SDH) Dimethyl malonate is able to cross the blood-brain barrier and hydrolyse to malonate Dimethyl malonate reduces neuronal apoptosis[1]
![eMolecules 38330-80-2 | Methyl potassium malonate | Ambeed | MFCD00014021 | 156.178 | C4H5KO4 | 98.000 | [K+].COC(=O)CC([O-])=O | 100g | 552569232](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000488554.jpg-250.jpg)
eMolecules 38330-80-2 | Methyl potassium malonate | Ambeed | MFCD00014021 | 156.178 | C4H5KO4 | 98.000 | [K+].COC(=O)CC([O-])=O | 100g | 552569232
Methyl potassium malonate | Ambeed | 38330-80-2 | MFCD00014021 | 156.178 | C4H5KO4 | 98.000 | [K+].COC(=O)CC([O-])=O | 100g | 552569232
Chem-Impex International, Inc. Malonic acid anhydrous | 141-82-2 | MFCD00002707 | 100G
Malonic acid anhydrous, 141-82-2, MFCD00002707, 100G
eMolecules 40637-56-7 | Dimethyl 2-allylmalonate | Ambeed | MFCD00014959 | 172.180 | C8H12O4 | 98.000 | COC(=O)C(CC=C)C(=O)OC | 5g | 552604694
Dimethyl 2-allylmalonate | Ambeed | 40637-56-7 | MFCD00014959 | 172.180 | C8H12O4 | 98.000 | COC(=O)C(CC=C)C(=O)OC | 5g | 552604694
Sigma Aldrich Fine Chemicals Biosciences Malonic acid anhydrous, free-flowing, Redi-Dri(TM), ReagentPlus(R), 99% | 141-82-2 | MFCD00002707 | 2.5KG
Malonic acid anhydrous, free-flowing, Redi-Dri(TM), ReagentPlus(R), 99% | Purity: 99% | Mol Wt: 104.06 | 141-82-2 | MFCD00002707 | 2.5KG
Chem-Impex International, Inc. Malonic acid anhydrous | 141-82-2 | MFCD00002707 | 1KG
Malonic acid anhydrous, 141-82-2, MFCD00002707, 1KG